C12H12N4O2 — CID 51050088
1,1-bis(cyanomethyl)-3-(4-methoxyphenyl)urea (PubChem CID 51050088) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1,1-bis(cyanomethyl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1,1-bis(cyanomethyl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 51050088 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1,1-bis(cyanomethyl)-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(CC#N)CC#N)cc1 |
| InChI | InChI=1S/C12H12N4O2/c1-18-11-4-2-10(3-5-11)15-12(17)16(8-6-13)9-7-14/h2-5H,8-9H2,1H3,(H,15,17) |
| InChIKey | CSCLTPKAUXZVNR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|