C18H22N4O4 — CID 17191785
N-[3-[bis(2-cyanoethyl)amino]-3-oxopropyl]-3,5-dimethoxybenzamide (PubChem CID 17191785) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[3-[bis(2-cyanoethyl)amino]-3-oxopropyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-[bis(2-cyanoethyl)amino]-3-oxopropyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 17191785 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[3-[bis(2-cyanoethyl)amino]-3-oxopropyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCC(=O)N(CCC#N)CCC#N)c1 |
| InChI | InChI=1S/C18H22N4O4/c1-25-15-11-14(12-16(13-15)26-2)18(24)21-8-5-17(23)22(9-3-6-19)10-4-7-20/h11-13H,3-5,8-10H2,1-2H3,(H,21,24) |
| InChIKey | NPERGTJGVYTASW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |