C15H22N2O4 — CID 118595720
[4-(methoxymethyl)phenyl] N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate (PubChem CID 118595720) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is [4-(methoxymethyl)phenyl] N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate.
| Compound Name | [4-(methoxymethyl)phenyl] N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118595720 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [4-(methoxymethyl)phenyl] N-[2-[acetyl(methyl)amino]ethyl]-N-methylcarbamate |
| SMILES | COCc1ccc(OC(=O)N(C)CCN(C)C(C)=O)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-12(18)16(2)9-10-17(3)15(19)21-14-7-5-13(6-8-14)11-20-4/h5-8H,9-11H2,1-4H3 |
| InChIKey | DRWHGTYSQYYDPB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |