C21H31F3N2O5 — CID 139983013
[4-(trifluoromethyl)phenyl] N-[4-[4-(dimethoxyamino)butoxy]cyclohexyl]-N-methylcarbamate (PubChem CID 139983013) has the molecular formula C21H31F3N2O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] N-[4-[4-(dimethoxyamino)butoxy]cyclohexyl]-N-methylcarbamate.
| Compound Name | [4-(trifluoromethyl)phenyl] N-[4-[4-(dimethoxyamino)butoxy]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 139983013 |
| Molecular Formula | C21H31F3N2O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] N-[4-[4-(dimethoxyamino)butoxy]cyclohexyl]-N-methylcarbamate |
| SMILES | CON(CCCCOC1CCC(N(C)C(=O)Oc2ccc(C(F)(F)F)cc2)CC1)OC |
| InChI | InChI=1S/C21H31F3N2O5/c1-25(20(27)31-19-10-6-16(7-11-19)21(22,23)24)17-8-12-18(13-9-17)30-15-5-4-14-26(28-2)29-3/h6-7,10-11,17-18H,4-5,8-9,12-15H2,1-3H3 |
| InChIKey | YIYMZTMFRCZSKE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|