C21H29F3N2OS — CID 10158730
N-methyl-N-[4-[3-(prop-2-enylamino)propoxy]cyclohexyl]-4-(trifluoromethyl)benzenecarbothioamide (PubChem CID 10158730) has the molecular formula C21H29F3N2OS and a molecular weight of 414.54 g/mol. Its IUPAC name is N-methyl-N-[4-[3-(prop-2-enylamino)propoxy]cyclohexyl]-4-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | N-methyl-N-[4-[3-(prop-2-enylamino)propoxy]cyclohexyl]-4-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 10158730 |
| Molecular Formula | C21H29F3N2OS |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-methyl-N-[4-[3-(prop-2-enylamino)propoxy]cyclohexyl]-4-(trifluoromethyl)benzenecarbothioamide |
| SMILES | C=CCNCCCOC1CCC(N(C)C(=S)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H29F3N2OS/c1-3-13-25-14-4-15-27-19-11-9-18(10-12-19)26(2)20(28)16-5-7-17(8-6-16)21(22,23)24/h3,5-8,18-19,25H,1,4,9-15H2,2H3 |
| InChIKey | AEYFIANZGBNAJR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|