C22H35FN2O2 — CID 70021312
4-fluoro-N,3-dimethyl-N-[4-[6-(methylamino)hexoxy]cyclohexyl]benzamide (PubChem CID 70021312) has the molecular formula C22H35FN2O2 and a molecular weight of 378.53 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethyl-N-[4-[6-(methylamino)hexoxy]cyclohexyl]benzamide.
| Compound Name | 4-fluoro-N,3-dimethyl-N-[4-[6-(methylamino)hexoxy]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 70021312 |
| Molecular Formula | C22H35FN2O2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 4-fluoro-N,3-dimethyl-N-[4-[6-(methylamino)hexoxy]cyclohexyl]benzamide |
| SMILES | CNCCCCCCOC1CCC(N(C)C(=O)c2ccc(F)c(C)c2)CC1 |
| InChI | InChI=1S/C22H35FN2O2/c1-17-16-18(8-13-21(17)23)22(26)25(3)19-9-11-20(12-10-19)27-15-7-5-4-6-14-24-2/h8,13,16,19-20,24H,4-7,9-12,14-15H2,1-3H3 |
| InChIKey | GXJCEVWXQHWUJG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|