C25H41ClN2O4 — CID 69194852
(4-chlorophenyl) N-[4-[6-[ethyl(2-methoxyethyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate (PubChem CID 69194852) has the molecular formula C25H41ClN2O4 and a molecular weight of 469.07 g/mol. Its IUPAC name is (4-chlorophenyl) N-[4-[6-[ethyl(2-methoxyethyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate.
| Compound Name | (4-chlorophenyl) N-[4-[6-[ethyl(2-methoxyethyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 69194852 |
| Molecular Formula | C25H41ClN2O4 |
| Molecular Weight | 469.07 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (4-chlorophenyl) N-[4-[6-[ethyl(2-methoxyethyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate |
| SMILES | CCN(CCCCCCOC1CCC(N(C)C(=O)Oc2ccc(Cl)cc2)CC1)CCOC |
| InChI | InChI=1S/C25H41ClN2O4/c1-4-28(18-20-30-3)17-7-5-6-8-19-31-23-15-11-22(12-16-23)27(2)25(29)32-24-13-9-21(26)10-14-24/h9-10,13-14,22-23H,4-8,11-12,15-20H2,1-3H3 |
| InChIKey | RDAWIJPGAICSQM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.07 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|