C25H43ClN2O3S — CID 70022140
4-chloro-N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]benzenesulfonamide (PubChem CID 70022140) has the molecular formula C25H43ClN2O3S and a molecular weight of 487.15 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70022140 |
| Molecular Formula | C25H43ClN2O3S |
| Molecular Weight | 487.15 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 4-chloro-N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]benzenesulfonamide |
| SMILES | CCCCCN(C)CCCCCCOC1CCC(N(C)S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H43ClN2O3S/c1-4-5-8-19-27(2)20-9-6-7-10-21-31-24-15-13-23(14-16-24)28(3)32(29,30)25-17-11-22(26)12-18-25/h11-12,17-18,23-24H,4-10,13-16,19-21H2,1-3H3 |
| InChIKey | YIELBJVFYARHFU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.15 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|