C24H45N3O4S — CID 70022041
2-[[[methyl-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]sulfamoyl]amino]methyl]furan (PubChem CID 70022041) has the molecular formula C24H45N3O4S and a molecular weight of 471.71 g/mol. Its IUPAC name is 2-[[[methyl-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]sulfamoyl]amino]methyl]furan.
| Compound Name | 2-[[[methyl-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]sulfamoyl]amino]methyl]furan |
|---|---|
| PubChem CID | 70022041 |
| Molecular Formula | C24H45N3O4S |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 2-[[[methyl-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]sulfamoyl]amino]methyl]furan |
| SMILES | CCCCCN(C)CCCCCCOC1CCC(N(C)S(=O)(=O)NCc2ccco2)CC1 |
| InChI | InChI=1S/C24H45N3O4S/c1-4-5-8-17-26(2)18-9-6-7-10-19-30-23-15-13-22(14-16-23)27(3)32(28,29)25-21-24-12-11-20-31-24/h11-12,20,22-23,25H,4-10,13-19,21H2,1-3H3 |
| InChIKey | AYWLQLKYJOSEHT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|