C28H49N3O2 — CID 70022878
3-(2,4-dimethylphenyl)-1-methyl-1-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]urea (PubChem CID 70022878) has the molecular formula C28H49N3O2 and a molecular weight of 459.72 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-methyl-1-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]urea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-methyl-1-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]urea |
|---|---|
| PubChem CID | 70022878 |
| Molecular Formula | C28H49N3O2 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.38 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-methyl-1-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]urea |
| SMILES | CCCCCN(C)CCCCCCOC1CCC(N(C)C(=O)Nc2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C28H49N3O2/c1-6-7-10-19-30(4)20-11-8-9-12-21-33-26-16-14-25(15-17-26)31(5)28(32)29-27-18-13-23(2)22-24(27)3/h13,18,22,25-26H,6-12,14-17,19-21H2,1-5H3,(H,29,32) |
| InChIKey | YNPQSAGNWUGOCG-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|