C17H36N2O4S — CID 70012762
4-[6-[methyl(pentyl)amino]hexoxy]piperidine-1-sulfonic acid (PubChem CID 70012762) has the molecular formula C17H36N2O4S and a molecular weight of 364.55 g/mol. Its IUPAC name is 4-[6-[methyl(pentyl)amino]hexoxy]piperidine-1-sulfonic acid.
| Compound Name | 4-[6-[methyl(pentyl)amino]hexoxy]piperidine-1-sulfonic acid |
|---|---|
| PubChem CID | 70012762 |
| Molecular Formula | C17H36N2O4S |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-[6-[methyl(pentyl)amino]hexoxy]piperidine-1-sulfonic acid |
| SMILES | CCCCCN(C)CCCCCCOC1CCN(S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C17H36N2O4S/c1-3-4-7-12-18(2)13-8-5-6-9-16-23-17-10-14-19(15-11-17)24(20,21)22/h17H,3-16H2,1-2H3,(H,20,21,22) |
| InChIKey | ZFKNTJCIRWQMDS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|