C15H30N2O4S — CID 22279392
4-[6-[methyl(prop-2-enyl)amino]hexoxy]piperidine-1-sulfonic acid (PubChem CID 22279392) has the molecular formula C15H30N2O4S and a molecular weight of 334.48 g/mol. Its IUPAC name is 4-[6-[methyl(prop-2-enyl)amino]hexoxy]piperidine-1-sulfonic acid.
| Compound Name | 4-[6-[methyl(prop-2-enyl)amino]hexoxy]piperidine-1-sulfonic acid |
|---|---|
| PubChem CID | 22279392 |
| Molecular Formula | C15H30N2O4S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-[6-[methyl(prop-2-enyl)amino]hexoxy]piperidine-1-sulfonic acid |
| SMILES | C=CCN(C)CCCCCCOC1CCN(S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C15H30N2O4S/c1-3-10-16(2)11-6-4-5-7-14-21-15-8-12-17(13-9-15)22(18,19)20/h3,15H,1,4-14H2,2H3,(H,18,19,20) |
| InChIKey | UAKZVTIDBPLLRY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|