C24H35ClN2O3S — CID 23446582
N-[4-[6-[butyl(methyl)amino]hexoxy]phenyl]-4-chloro-N-methylbenzenesulfonamide (PubChem CID 23446582) has the molecular formula C24H35ClN2O3S and a molecular weight of 467.08 g/mol. Its IUPAC name is N-[4-[6-[butyl(methyl)amino]hexoxy]phenyl]-4-chloro-N-methylbenzenesulfonamide.
| Compound Name | N-[4-[6-[butyl(methyl)amino]hexoxy]phenyl]-4-chloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23446582 |
| Molecular Formula | C24H35ClN2O3S |
| Molecular Weight | 467.08 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-[4-[6-[butyl(methyl)amino]hexoxy]phenyl]-4-chloro-N-methylbenzenesulfonamide |
| SMILES | CCCCN(C)CCCCCCOc1ccc(N(C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H35ClN2O3S/c1-4-5-18-26(2)19-8-6-7-9-20-30-23-14-12-22(13-15-23)27(3)31(28,29)24-16-10-21(25)11-17-24/h10-17H,4-9,18-20H2,1-3H3 |
| InChIKey | REFFSMSNHLMGNJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.08 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|