C12H16Br3NO3S — CID 23576859
1,1,1-tribromo-N-(4-butoxyphenyl)-N-methylmethanesulfonamide (PubChem CID 23576859) has the molecular formula C12H16Br3NO3S and a molecular weight of 494.04 g/mol. Its IUPAC name is 1,1,1-tribromo-N-(4-butoxyphenyl)-N-methylmethanesulfonamide.
| Compound Name | 1,1,1-tribromo-N-(4-butoxyphenyl)-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 23576859 |
| Molecular Formula | C12H16Br3NO3S |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 490.84 |
| IUPAC Name | 1,1,1-tribromo-N-(4-butoxyphenyl)-N-methylmethanesulfonamide |
| SMILES | CCCCOc1ccc(N(C)S(=O)(=O)C(Br)(Br)Br)cc1 |
| InChI | InChI=1S/C12H16Br3NO3S/c1-3-4-9-19-11-7-5-10(6-8-11)16(2)20(17,18)12(13,14)15/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | DZSSBEPCWMHWFH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|