C16H18ClNO3S — CID 26057393
4-chloro-N-methyl-N-[2-(4-methylphenoxy)ethyl]benzenesulfonamide (PubChem CID 26057393) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[2-(4-methylphenoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-methyl-N-[2-(4-methylphenoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26057393 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-chloro-N-methyl-N-[2-(4-methylphenoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(OCCN(C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H18ClNO3S/c1-13-3-7-15(8-4-13)21-12-11-18(2)22(19,20)16-9-5-14(17)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | KXTXUQKGKTXTOG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |