C16H18BrNO3S — CID 2457467
N-[2-(3-bromophenoxy)ethyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 2457467) has the molecular formula C16H18BrNO3S and a molecular weight of 384.30 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2457467 |
| Molecular Formula | C16H18BrNO3S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CCOc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C16H18BrNO3S/c1-13-6-8-16(9-7-13)22(19,20)18(2)10-11-21-15-5-3-4-14(17)12-15/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | MIRINTIBSUAVAE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |