C10H13Br2NO2S — CID 106441720
3-bromo-N-(3-bromopropyl)-N-methylbenzenesulfonamide (PubChem CID 106441720) has the molecular formula C10H13Br2NO2S and a molecular weight of 371.09 g/mol. Its IUPAC name is 3-bromo-N-(3-bromopropyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-bromo-N-(3-bromopropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106441720 |
| Molecular Formula | C10H13Br2NO2S |
| Molecular Weight | 371.09 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | 3-bromo-N-(3-bromopropyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CCCBr)S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C10H13Br2NO2S/c1-13(7-3-6-11)16(14,15)10-5-2-4-9(12)8-10/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | NPJPBEUNRMWWRL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.09 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|