C21H29ClN2O3S2 — CID 91535537
5-chloro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiophene-2-sulfonamide (PubChem CID 91535537) has the molecular formula C21H29ClN2O3S2 and a molecular weight of 457.06 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91535537 |
| Molecular Formula | C21H29ClN2O3S2 |
| Molecular Weight | 457.06 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 5-chloro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiophene-2-sulfonamide |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)S(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C21H29ClN2O3S2/c1-4-15-23(2)16-7-5-6-8-17-27-19-11-9-18(10-12-19)24(3)29(25,26)21-14-13-20(22)28-21/h4,9-14H,1,5-8,15-17H2,2-3H3 |
| InChIKey | RKBJPPANKYDFFE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.06 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|