C24H31BrN2O3 — CID 68614365
(4-bromophenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate (PubChem CID 68614365) has the molecular formula C24H31BrN2O3 and a molecular weight of 475.43 g/mol. Its IUPAC name is (4-bromophenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate.
| Compound Name | (4-bromophenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 68614365 |
| Molecular Formula | C24H31BrN2O3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (4-bromophenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)C(=O)Oc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H31BrN2O3/c1-4-17-26(2)18-7-5-6-8-19-29-22-15-11-21(12-16-22)27(3)24(28)30-23-13-9-20(25)10-14-23/h4,9-16H,1,5-8,17-19H2,2-3H3 |
| InChIKey | POVXRMYJDHYVJD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|