C21H33N3O4S — CID 87515888
methyl 2-[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamoyl]-sulfanylamino]acetate (PubChem CID 87515888) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is methyl 2-[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamoyl]-sulfanylamino]acetate.
| Compound Name | methyl 2-[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamoyl]-sulfanylamino]acetate |
|---|---|
| PubChem CID | 87515888 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | methyl 2-[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamoyl]-sulfanylamino]acetate |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)C(=O)N(S)CC(=O)OC)cc1 |
| InChI | InChI=1S/C21H33N3O4S/c1-5-14-22(2)15-8-6-7-9-16-28-19-12-10-18(11-13-19)23(3)21(26)24(29)17-20(25)27-4/h5,10-13,29H,1,6-9,14-17H2,2-4H3 |
| InChIKey | PNBYFVIVSSYQIC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|