C23H33N3O2S — CID 87515970
3-(furan-2-ylmethyl)-1-methyl-1-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiourea (PubChem CID 87515970) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1-methyl-1-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiourea.
| Compound Name | 3-(furan-2-ylmethyl)-1-methyl-1-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 87515970 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1-methyl-1-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]thiourea |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)C(=S)NCc2ccco2)cc1 |
| InChI | InChI=1S/C23H33N3O2S/c1-4-15-25(2)16-7-5-6-8-17-27-21-13-11-20(12-14-21)26(3)23(29)24-19-22-10-9-18-28-22/h4,9-14,18H,1,5-8,15-17,19H2,2-3H3,(H,24,29) |
| InChIKey | ZBIQETNSGBXBAZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 40.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|