C22H36N2O3 — CID 68614271
tert-butyl N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate (PubChem CID 68614271) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 68614271 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | tert-butyl N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H36N2O3/c1-7-16-23(5)17-10-8-9-11-18-26-20-14-12-19(13-15-20)24(6)21(25)27-22(2,3)4/h7,12-15H,1,8-11,16-18H2,2-6H3 |
| InChIKey | CCQRMYUBNPZMGN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|