C26H32FN3O2 — CID 90990305
5-fluoro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-1H-indole-2-carboxamide (PubChem CID 90990305) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is 5-fluoro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90990305 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 5-fluoro-N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-1H-indole-2-carboxamide |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)C(=O)c2cc3cc(F)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C26H32FN3O2/c1-4-15-29(2)16-7-5-6-8-17-32-23-12-10-22(11-13-23)30(3)26(31)25-19-20-18-21(27)9-14-24(20)28-25/h4,9-14,18-19,28H,1,5-8,15-17H2,2-3H3 |
| InChIKey | NOEBEPMLQIXEBR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|