C25H34N2O3 — CID 68615610
(4-methylphenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate (PubChem CID 68615610) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is (4-methylphenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate.
| Compound Name | (4-methylphenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 68615610 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (4-methylphenyl) N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]carbamate |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)C(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O3/c1-5-18-26(3)19-8-6-7-9-20-29-23-16-12-22(13-17-23)27(4)25(28)30-24-14-10-21(2)11-15-24/h5,10-17H,1,6-9,18-20H2,2-4H3 |
| InChIKey | OYZFTJJIUFNFBN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|