C21H34N2O5S — CID 87515980
ethyl 2-(sulfonylamino)acetate;N-methyl-6-(4-methylphenoxy)-N-prop-2-enylhexan-1-amine (PubChem CID 87515980) has the molecular formula C21H34N2O5S and a molecular weight of 426.58 g/mol. Its IUPAC name is ethyl 2-(sulfonylamino)acetate;N-methyl-6-(4-methylphenoxy)-N-prop-2-enylhexan-1-amine.
| Compound Name | ethyl 2-(sulfonylamino)acetate;N-methyl-6-(4-methylphenoxy)-N-prop-2-enylhexan-1-amine |
|---|---|
| PubChem CID | 87515980 |
| Molecular Formula | C21H34N2O5S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | ethyl 2-(sulfonylamino)acetate;N-methyl-6-(4-methylphenoxy)-N-prop-2-enylhexan-1-amine |
| SMILES | C=CCN(C)CCCCCCOc1ccc(C)cc1.CCOC(=O)CN=S(=O)=O |
| InChI | InChI=1S/C17H27NO.C4H7NO4S/c1-4-13-18(3)14-7-5-6-8-15-19-17-11-9-16(2)10-12-17;1-2-9-4(6)3-5-10(7)8/h4,9-12H,1,5-8,13-15H2,2-3H3;2-3H2,1H3 |
| InChIKey | LUMZNHVHIOFDEE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|