C21H25Br2NO2 — CID 19043714
(4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]butoxy]phenyl]methanone;hydrobromide (PubChem CID 19043714) has the molecular formula C21H25Br2NO2 and a molecular weight of 483.24 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]butoxy]phenyl]methanone;hydrobromide.
| Compound Name | (4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]butoxy]phenyl]methanone;hydrobromide |
|---|---|
| PubChem CID | 19043714 |
| Molecular Formula | C21H25Br2NO2 |
| Molecular Weight | 483.24 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | (4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]butoxy]phenyl]methanone;hydrobromide |
| SMILES | Br.C=CCN(C)CCCCOc1ccc(C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H24BrNO2.BrH/c1-3-14-23(2)15-4-5-16-25-20-12-8-18(9-13-20)21(24)17-6-10-19(22)11-7-17;/h3,6-13H,1,4-5,14-16H2,2H3;1H |
| InChIKey | XWDMLZQHUAQDIN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.24 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|