C23H29BrFNO — CID 57165433
6-[4-[(4-bromophenyl)methyl]-3-fluorophenoxy]-N-methyl-N-prop-2-enylhexan-1-amine (PubChem CID 57165433) has the molecular formula C23H29BrFNO and a molecular weight of 434.39 g/mol. Its IUPAC name is 6-[4-[(4-bromophenyl)methyl]-3-fluorophenoxy]-N-methyl-N-prop-2-enylhexan-1-amine.
| Compound Name | 6-[4-[(4-bromophenyl)methyl]-3-fluorophenoxy]-N-methyl-N-prop-2-enylhexan-1-amine |
|---|---|
| PubChem CID | 57165433 |
| Molecular Formula | C23H29BrFNO |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 6-[4-[(4-bromophenyl)methyl]-3-fluorophenoxy]-N-methyl-N-prop-2-enylhexan-1-amine |
| SMILES | C=CCN(C)CCCCCCOc1ccc(Cc2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C23H29BrFNO/c1-3-14-26(2)15-6-4-5-7-16-27-22-13-10-20(23(25)18-22)17-19-8-11-21(24)12-9-19/h3,8-13,18H,1,4-7,14-17H2,2H3 |
| InChIKey | UQJPQFLPMZIRHE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|