C21H27BrFNO — CID 138741074
6-[4-[2-(4-bromophenyl)ethyl]-3-fluorophenoxy]-N-methylhexan-1-amine (PubChem CID 138741074) has the molecular formula C21H27BrFNO and a molecular weight of 408.36 g/mol. Its IUPAC name is 6-[4-[2-(4-bromophenyl)ethyl]-3-fluorophenoxy]-N-methylhexan-1-amine.
| Compound Name | 6-[4-[2-(4-bromophenyl)ethyl]-3-fluorophenoxy]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 138741074 |
| Molecular Formula | C21H27BrFNO |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 6-[4-[2-(4-bromophenyl)ethyl]-3-fluorophenoxy]-N-methylhexan-1-amine |
| SMILES | CNCCCCCCOc1ccc(CCc2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C21H27BrFNO/c1-24-14-4-2-3-5-15-25-20-13-10-18(21(23)16-20)9-6-17-7-11-19(22)12-8-17/h7-8,10-13,16,24H,2-6,9,14-15H2,1H3 |
| InChIKey | YRQGXKLJFWXQPS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|