C20H23BrFN3O — CID 138734236
6-[4-(6-bromo-1H-indazol-3-yl)-3-fluorophenoxy]-N-methylhexan-1-amine (PubChem CID 138734236) has the molecular formula C20H23BrFN3O and a molecular weight of 420.33 g/mol. Its IUPAC name is 6-[4-(6-bromo-1H-indazol-3-yl)-3-fluorophenoxy]-N-methylhexan-1-amine.
| Compound Name | 6-[4-(6-bromo-1H-indazol-3-yl)-3-fluorophenoxy]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 138734236 |
| Molecular Formula | C20H23BrFN3O |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 6-[4-(6-bromo-1H-indazol-3-yl)-3-fluorophenoxy]-N-methylhexan-1-amine |
| SMILES | CNCCCCCCOc1ccc(-c2n[nH]c3cc(Br)ccc23)c(F)c1 |
| InChI | InChI=1S/C20H23BrFN3O/c1-23-10-4-2-3-5-11-26-15-7-9-16(18(22)13-15)20-17-8-6-14(21)12-19(17)24-25-20/h6-9,12-13,23H,2-5,10-11H2,1H3,(H,24,25) |
| InChIKey | WIJXMGAYMDJQEV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|