C24H29BrFN3O — CID 138734358
6-[4-(6-bromo-1-methylindazol-3-yl)-3-fluorophenoxy]-N-(cyclopropylmethyl)hexan-1-amine (PubChem CID 138734358) has the molecular formula C24H29BrFN3O and a molecular weight of 474.42 g/mol. Its IUPAC name is 6-[4-(6-bromo-1-methylindazol-3-yl)-3-fluorophenoxy]-N-(cyclopropylmethyl)hexan-1-amine.
| Compound Name | 6-[4-(6-bromo-1-methylindazol-3-yl)-3-fluorophenoxy]-N-(cyclopropylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 138734358 |
| Molecular Formula | C24H29BrFN3O |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 6-[4-(6-bromo-1-methylindazol-3-yl)-3-fluorophenoxy]-N-(cyclopropylmethyl)hexan-1-amine |
| SMILES | Cn1nc(-c2ccc(OCCCCCCNCC3CC3)cc2F)c2ccc(Br)cc21 |
| InChI | InChI=1S/C24H29BrFN3O/c1-29-23-14-18(25)8-10-21(23)24(28-29)20-11-9-19(15-22(20)26)30-13-5-3-2-4-12-27-16-17-6-7-17/h8-11,14-15,17,27H,2-7,12-13,16H2,1H3 |
| InChIKey | NHHOGTYAJQTKII-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|