C21H28BrFN2O — CID 138741073
6-[4-[(S)-(4-bromophenyl)-(methylamino)methyl]-3-fluorophenoxy]-N-methylhexan-1-amine (PubChem CID 138741073) has the molecular formula C21H28BrFN2O and a molecular weight of 423.37 g/mol. Its IUPAC name is 6-[4-[(S)-(4-bromophenyl)-(methylamino)methyl]-3-fluorophenoxy]-N-methylhexan-1-amine.
| Compound Name | 6-[4-[(S)-(4-bromophenyl)-(methylamino)methyl]-3-fluorophenoxy]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 138741073 |
| Molecular Formula | C21H28BrFN2O |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 6-[4-[(S)-(4-bromophenyl)-(methylamino)methyl]-3-fluorophenoxy]-N-methylhexan-1-amine |
| SMILES | CNCCCCCCOc1ccc([C@@H](NC)c2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C21H28BrFN2O/c1-24-13-5-3-4-6-14-26-18-11-12-19(20(23)15-18)21(25-2)16-7-9-17(22)10-8-16/h7-12,15,21,24-25H,3-6,13-14H2,1-2H3/t21-/m0/s1 |
| InChIKey | BDRBPDLCIOYUFB-NRFANRHFSA-N |
| XLogP | 5.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|