C28H34BrNO6S — CID 18434294
(4-bromophenyl)-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]-2-methylsulfanylphenyl]methanone;(E)-but-2-enedioic acid (PubChem CID 18434294) has the molecular formula C28H34BrNO6S and a molecular weight of 592.55 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]-2-methylsulfanylphenyl]methanone;(E)-but-2-enedioic acid.
| Compound Name | (4-bromophenyl)-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]-2-methylsulfanylphenyl]methanone;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 18434294 |
| Molecular Formula | C28H34BrNO6S |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | (4-bromophenyl)-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]-2-methylsulfanylphenyl]methanone;(E)-but-2-enedioic acid |
| SMILES | C=CCN(C)CCCCCCOc1ccc(C(=O)c2ccc(Br)cc2)c(SC)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H30BrNO2S.C4H4O4/c1-4-15-26(2)16-7-5-6-8-17-28-21-13-14-22(23(18-21)29-3)24(27)19-9-11-20(25)12-10-19;5-3(6)1-2-4(7)8/h4,9-14,18H,1,5-8,15-17H2,2-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZWCAUIUMZVEUGA-WLHGVMLRSA-N |
| XLogP | 6.17 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|