C25H34BrClN2O2 — CID 18434159
(4-bromophenyl)-[2-(dimethylamino)-4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]methanone;hydrochloride (PubChem CID 18434159) has the molecular formula C25H34BrClN2O2 and a molecular weight of 509.92 g/mol. Its IUPAC name is (4-bromophenyl)-[2-(dimethylamino)-4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]methanone;hydrochloride.
| Compound Name | (4-bromophenyl)-[2-(dimethylamino)-4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 18434159 |
| Molecular Formula | C25H34BrClN2O2 |
| Molecular Weight | 509.92 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | (4-bromophenyl)-[2-(dimethylamino)-4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]methanone;hydrochloride |
| SMILES | C=CCN(C)CCCCCCOc1ccc(C(=O)c2ccc(Br)cc2)c(N(C)C)c1.Cl |
| InChI | InChI=1S/C25H33BrN2O2.ClH/c1-5-16-28(4)17-8-6-7-9-18-30-22-14-15-23(24(19-22)27(2)3)25(29)20-10-12-21(26)13-11-20;/h5,10-15,19H,1,6-9,16-18H2,2-4H3;1H |
| InChIKey | ZNPVOIDMSYUURM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.92 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|