C24H30BrN3O — CID 67684787
6-[[4-(4-bromophenyl)-1,4-dihydroquinazolin-7-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine (PubChem CID 67684787) has the molecular formula C24H30BrN3O and a molecular weight of 456.43 g/mol. Its IUPAC name is 6-[[4-(4-bromophenyl)-1,4-dihydroquinazolin-7-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine.
| Compound Name | 6-[[4-(4-bromophenyl)-1,4-dihydroquinazolin-7-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine |
|---|---|
| PubChem CID | 67684787 |
| Molecular Formula | C24H30BrN3O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 6-[[4-(4-bromophenyl)-1,4-dihydroquinazolin-7-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine |
| SMILES | C=CCN(C)CCCCCCOc1ccc2c(c1)NC=NC2c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H30BrN3O/c1-3-14-28(2)15-6-4-5-7-16-29-21-12-13-22-23(17-21)26-18-27-24(22)19-8-10-20(25)11-9-19/h3,8-13,17-18,24H,1,4-7,14-16H2,2H3,(H,26,27) |
| InChIKey | WQTKTIURSFBSGK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|