C23H27ClN2O2 — CID 70024462
(4-chlorophenyl)-[5-[4-[methyl(prop-2-enyl)amino]butoxy]-2,3-dihydro-1H-indol-3-yl]methanone (PubChem CID 70024462) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is (4-chlorophenyl)-[5-[4-[methyl(prop-2-enyl)amino]butoxy]-2,3-dihydro-1H-indol-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[5-[4-[methyl(prop-2-enyl)amino]butoxy]-2,3-dihydro-1H-indol-3-yl]methanone |
|---|---|
| PubChem CID | 70024462 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (4-chlorophenyl)-[5-[4-[methyl(prop-2-enyl)amino]butoxy]-2,3-dihydro-1H-indol-3-yl]methanone |
| SMILES | C=CCN(C)CCCCOc1ccc2c(c1)C(C(=O)c1ccc(Cl)cc1)CN2 |
| InChI | InChI=1S/C23H27ClN2O2/c1-3-12-26(2)13-4-5-14-28-19-10-11-22-20(15-19)21(16-25-22)23(27)17-6-8-18(24)9-7-17/h3,6-11,15,21,25H,1,4-5,12-14,16H2,2H3 |
| InChIKey | IWNDOPYOCRJXFE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|