C22H33ClN2O3 — CID 69197969
(4-chlorophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxymethyl]cyclohexyl]carbamate (PubChem CID 69197969) has the molecular formula C22H33ClN2O3 and a molecular weight of 408.97 g/mol. Its IUPAC name is (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxymethyl]cyclohexyl]carbamate.
| Compound Name | (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxymethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 69197969 |
| Molecular Formula | C22H33ClN2O3 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxymethyl]cyclohexyl]carbamate |
| SMILES | C=CCN(C)CCCOCC1CCC(N(C)C(=O)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H33ClN2O3/c1-4-14-24(2)15-5-16-27-17-18-6-10-20(11-7-18)25(3)22(26)28-21-12-8-19(23)9-13-21/h4,8-9,12-13,18,20H,1,5-7,10-11,14-17H2,2-3H3 |
| InChIKey | KCDWXMMKBBFONJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|