C26H41F3N2O2 — CID 70020545
[4-(trifluoromethyl)phenyl] N-methyl-N-[4-[5-[methyl(pentyl)amino]pentyl]cyclohexyl]carbamate (PubChem CID 70020545) has the molecular formula C26H41F3N2O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] N-methyl-N-[4-[5-[methyl(pentyl)amino]pentyl]cyclohexyl]carbamate.
| Compound Name | [4-(trifluoromethyl)phenyl] N-methyl-N-[4-[5-[methyl(pentyl)amino]pentyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 70020545 |
| Molecular Formula | C26H41F3N2O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] N-methyl-N-[4-[5-[methyl(pentyl)amino]pentyl]cyclohexyl]carbamate |
| SMILES | CCCCCN(C)CCCCCC1CCC(N(C)C(=O)Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C26H41F3N2O2/c1-4-5-8-19-30(2)20-9-6-7-10-21-11-15-23(16-12-21)31(3)25(32)33-24-17-13-22(14-18-24)26(27,28)29/h13-14,17-18,21,23H,4-12,15-16,19-20H2,1-3H3 |
| InChIKey | VKVZRAXOHKEJDN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|