C22H29ClN2O2 — CID 69195206
(4-chlorophenyl) N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]but-1-ynyl]cyclohexyl]carbamate (PubChem CID 69195206) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is (4-chlorophenyl) N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]but-1-ynyl]cyclohexyl]carbamate.
| Compound Name | (4-chlorophenyl) N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]but-1-ynyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 69195206 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (4-chlorophenyl) N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]but-1-ynyl]cyclohexyl]carbamate |
| SMILES | C=CCN(C)CCC#CC1CCC(N(C)C(=O)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H29ClN2O2/c1-4-16-24(2)17-6-5-7-18-8-12-20(13-9-18)25(3)22(26)27-21-14-10-19(23)11-15-21/h4,10-11,14-15,18,20H,1,6,8-9,12-13,16-17H2,2-3H3 |
| InChIKey | DTBVDWAEKYSBSJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|