C23H30BrNO2 — CID 45261576
[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-phenylmethanone;hydrobromide (PubChem CID 45261576) has the molecular formula C23H30BrNO2 and a molecular weight of 432.40 g/mol. Its IUPAC name is [4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-phenylmethanone;hydrobromide.
| Compound Name | [4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-phenylmethanone;hydrobromide |
|---|---|
| PubChem CID | 45261576 |
| Molecular Formula | C23H30BrNO2 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-phenylmethanone;hydrobromide |
| SMILES | Br.C=CCN(C)CCCCCCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H29NO2.BrH/c1-3-17-24(2)18-9-4-5-10-19-26-22-15-13-21(14-16-22)23(25)20-11-7-6-8-12-20;/h3,6-8,11-16H,1,4-5,9-10,17-19H2,2H3;1H |
| InChIKey | IIAAIEBACOSDCP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|