C22H24BrNO2S — CID 54072976
(4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]-2-methylsulfanylphenyl]methanone (PubChem CID 54072976) has the molecular formula C22H24BrNO2S and a molecular weight of 446.41 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]-2-methylsulfanylphenyl]methanone.
| Compound Name | (4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]-2-methylsulfanylphenyl]methanone |
|---|---|
| PubChem CID | 54072976 |
| Molecular Formula | C22H24BrNO2S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | (4-bromophenyl)-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]-2-methylsulfanylphenyl]methanone |
| SMILES | C=CCN(C)CC=CCOc1ccc(C(=O)c2ccc(Br)cc2)c(SC)c1 |
| InChI | InChI=1S/C22H24BrNO2S/c1-4-13-24(2)14-5-6-15-26-19-11-12-20(21(16-19)27-3)22(25)17-7-9-18(23)10-8-17/h4-12,16H,1,13-15H2,2-3H3 |
| InChIKey | MHTPZGRWMFWWLA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|