C21H21Br2NO2 — CID 68737945
[3-bromo-4-[(E)-4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-(4-bromophenyl)methanone (PubChem CID 68737945) has the molecular formula C21H21Br2NO2 and a molecular weight of 479.21 g/mol. Its IUPAC name is [3-bromo-4-[(E)-4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-(4-bromophenyl)methanone.
| Compound Name | [3-bromo-4-[(E)-4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-(4-bromophenyl)methanone |
|---|---|
| PubChem CID | 68737945 |
| Molecular Formula | C21H21Br2NO2 |
| Molecular Weight | 479.21 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | [3-bromo-4-[(E)-4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-(4-bromophenyl)methanone |
| SMILES | C=CCN(C)C/C=C/COc1ccc(C(=O)c2ccc(Br)cc2)cc1Br |
| InChI | InChI=1S/C21H21Br2NO2/c1-3-12-24(2)13-4-5-14-26-20-11-8-17(15-19(20)23)21(25)16-6-9-18(22)10-7-16/h3-11,15H,1,12-14H2,2H3/b5-4+ |
| InChIKey | QRYGFTKNLKIGEI-SNAWJCMRSA-N |
| XLogP | 5.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.21 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|