C21H18BrF4NO2 — CID 73444840
(4-bromophenyl)-[2,3,5,6-tetrafluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]methanone (PubChem CID 73444840) has the molecular formula C21H18BrF4NO2 and a molecular weight of 472.28 g/mol. Its IUPAC name is (4-bromophenyl)-[2,3,5,6-tetrafluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]methanone.
| Compound Name | (4-bromophenyl)-[2,3,5,6-tetrafluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]methanone |
|---|---|
| PubChem CID | 73444840 |
| Molecular Formula | C21H18BrF4NO2 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | (4-bromophenyl)-[2,3,5,6-tetrafluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]methanone |
| SMILES | C=CCN(C)CC=CCOc1c(F)c(F)c(C(=O)c2ccc(Br)cc2)c(F)c1F |
| InChI | InChI=1S/C21H18BrF4NO2/c1-3-10-27(2)11-4-5-12-29-21-18(25)16(23)15(17(24)19(21)26)20(28)13-6-8-14(22)9-7-13/h3-9H,1,10-12H2,2H3 |
| InChIKey | CLBORUHPPVCMBJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|