C24H27BrN2O2 — CID 18434220
(E)-4-[4-[(Z)-C-(4-bromophenyl)-N-prop-2-enoxycarbonimidoyl]phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine (PubChem CID 18434220) has the molecular formula C24H27BrN2O2 and a molecular weight of 455.40 g/mol. Its IUPAC name is (E)-4-[4-[(Z)-C-(4-bromophenyl)-N-prop-2-enoxycarbonimidoyl]phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine.
| Compound Name | (E)-4-[4-[(Z)-C-(4-bromophenyl)-N-prop-2-enoxycarbonimidoyl]phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine |
|---|---|
| PubChem CID | 18434220 |
| Molecular Formula | C24H27BrN2O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (E)-4-[4-[(Z)-C-(4-bromophenyl)-N-prop-2-enoxycarbonimidoyl]phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine |
| SMILES | C=CCO/N=C(\c1ccc(Br)cc1)c1ccc(OC/C=C/CN(C)CC=C)cc1 |
| InChI | InChI=1S/C24H27BrN2O2/c1-4-16-27(3)17-6-7-19-28-23-14-10-21(11-15-23)24(26-29-18-5-2)20-8-12-22(25)13-9-20/h4-15H,1-2,16-19H2,3H3/b7-6+,26-24+ |
| InChIKey | SLCRCPFBJDUCIC-BUFNDLNFSA-N |
| XLogP | 5.46 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|