C22H26BrNO2 — CID 70166225
(1R)-2-(4-bromophenyl)-1-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]ethanol (PubChem CID 70166225) has the molecular formula C22H26BrNO2 and a molecular weight of 416.36 g/mol. Its IUPAC name is (1R)-2-(4-bromophenyl)-1-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]ethanol.
| Compound Name | (1R)-2-(4-bromophenyl)-1-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 70166225 |
| Molecular Formula | C22H26BrNO2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (1R)-2-(4-bromophenyl)-1-[4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]ethanol |
| SMILES | C=CCN(C)CC=CCOc1ccc([C@H](O)Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H26BrNO2/c1-3-14-24(2)15-4-5-16-26-21-12-8-19(9-13-21)22(25)17-18-6-10-20(23)11-7-18/h3-13,22,25H,1,14-17H2,2H3/t22-/m1/s1 |
| InChIKey | HSIXCTQKIOFBLC-JOCHJYFZSA-N |
| XLogP | 4.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|