C20H23Br2NO2 — CID 70263560
(4-bromophenyl)-[4-[4-[ethyl(methyl)amino]but-2-enoxy]phenyl]methanone;hydrobromide (PubChem CID 70263560) has the molecular formula C20H23Br2NO2 and a molecular weight of 469.22 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[4-[ethyl(methyl)amino]but-2-enoxy]phenyl]methanone;hydrobromide.
| Compound Name | (4-bromophenyl)-[4-[4-[ethyl(methyl)amino]but-2-enoxy]phenyl]methanone;hydrobromide |
|---|---|
| PubChem CID | 70263560 |
| Molecular Formula | C20H23Br2NO2 |
| Molecular Weight | 469.22 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | (4-bromophenyl)-[4-[4-[ethyl(methyl)amino]but-2-enoxy]phenyl]methanone;hydrobromide |
| SMILES | Br.CCN(C)CC=CCOc1ccc(C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H22BrNO2.BrH/c1-3-22(2)14-4-5-15-24-19-12-8-17(9-13-19)20(23)16-6-10-18(21)11-7-16;/h4-13H,3,14-15H2,1-2H3;1H |
| InChIKey | WPWAWZPLXQTXCO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.22 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|