C21H20Br4O2 — CID 19761058
[4-[(E)-4-bromobut-2-enoxy]phenyl]-(4-bromophenyl)methanone;(E)-1,4-dibromobut-1-ene (PubChem CID 19761058) has the molecular formula C21H20Br4O2 and a molecular weight of 624.00 g/mol. Its IUPAC name is [4-[(E)-4-bromobut-2-enoxy]phenyl]-(4-bromophenyl)methanone;(E)-1,4-dibromobut-1-ene.
| Compound Name | [4-[(E)-4-bromobut-2-enoxy]phenyl]-(4-bromophenyl)methanone;(E)-1,4-dibromobut-1-ene |
|---|---|
| PubChem CID | 19761058 |
| Molecular Formula | C21H20Br4O2 |
| Molecular Weight | 624.00 g/mol |
| Exact Mass | 619.82 |
| IUPAC Name | [4-[(E)-4-bromobut-2-enoxy]phenyl]-(4-bromophenyl)methanone;(E)-1,4-dibromobut-1-ene |
| SMILES | Br/C=C/CCBr.O=C(c1ccc(Br)cc1)c1ccc(OC/C=C/CBr)cc1 |
| InChI | InChI=1S/C17H14Br2O2.C4H6Br2/c18-11-1-2-12-21-16-9-5-14(6-10-16)17(20)13-3-7-15(19)8-4-13;5-3-1-2-4-6/h1-10H,11-12H2;1,3H,2,4H2/b2-1+;3-1+ |
| InChIKey | KHSNAFPFASIKNO-FOJBITAESA-N |
| XLogP | 7.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.00 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|