C25H31Br2FN2O2 — CID 18434123
N-[4-(4-bromobenzoyl)-2-fluorophenyl]-N-[6-[methyl(prop-2-enyl)amino]hexyl]acetamide;hydrobromide (PubChem CID 18434123) has the molecular formula C25H31Br2FN2O2 and a molecular weight of 570.34 g/mol. Its IUPAC name is N-[4-(4-bromobenzoyl)-2-fluorophenyl]-N-[6-[methyl(prop-2-enyl)amino]hexyl]acetamide;hydrobromide.
| Compound Name | N-[4-(4-bromobenzoyl)-2-fluorophenyl]-N-[6-[methyl(prop-2-enyl)amino]hexyl]acetamide;hydrobromide |
|---|---|
| PubChem CID | 18434123 |
| Molecular Formula | C25H31Br2FN2O2 |
| Molecular Weight | 570.34 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | N-[4-(4-bromobenzoyl)-2-fluorophenyl]-N-[6-[methyl(prop-2-enyl)amino]hexyl]acetamide;hydrobromide |
| SMILES | Br.C=CCN(C)CCCCCCN(C(C)=O)c1ccc(C(=O)c2ccc(Br)cc2)cc1F |
| InChI | InChI=1S/C25H30BrFN2O2.BrH/c1-4-15-28(3)16-7-5-6-8-17-29(19(2)30)24-14-11-21(18-23(24)27)25(31)20-9-12-22(26)13-10-20;/h4,9-14,18H,1,5-8,15-17H2,2-3H3;1H |
| InChIKey | DAKAWTCJPJHSJF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.34 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|