C25H35N3O5S — CID 68614646
5-[[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]sulfamoyl]amino]methyl]-1,3-benzodioxole (PubChem CID 68614646) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is 5-[[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]sulfamoyl]amino]methyl]-1,3-benzodioxole.
| Compound Name | 5-[[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]sulfamoyl]amino]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 68614646 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 5-[[[methyl-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]sulfamoyl]amino]methyl]-1,3-benzodioxole |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C25H35N3O5S/c1-4-15-27(2)16-7-5-6-8-17-31-23-12-10-22(11-13-23)28(3)34(29,30)26-19-21-9-14-24-25(18-21)33-20-32-24/h4,9-14,18,26H,1,5-8,15-17,19-20H2,2-3H3 |
| InChIKey | OWCXICJGDHYOMJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|