C20H23NO3 — CID 54188372
(4-phenoxyphenyl) N-cyclohexyl-N-methylcarbamate (PubChem CID 54188372) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (4-phenoxyphenyl) N-cyclohexyl-N-methylcarbamate.
| Compound Name | (4-phenoxyphenyl) N-cyclohexyl-N-methylcarbamate |
|---|---|
| PubChem CID | 54188372 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (4-phenoxyphenyl) N-cyclohexyl-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1ccc(Oc2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H23NO3/c1-21(16-8-4-2-5-9-16)20(22)24-19-14-12-18(13-15-19)23-17-10-6-3-7-11-17/h3,6-7,10-16H,2,4-5,8-9H2,1H3 |
| InChIKey | PGSUZVFFYDPAOJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |