C22H26N2O3 — CID 91520177
[4-[acetyl(cyclohexyl)amino]phenyl] N-methyl-N-phenylcarbamate (PubChem CID 91520177) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is [4-[acetyl(cyclohexyl)amino]phenyl] N-methyl-N-phenylcarbamate.
| Compound Name | [4-[acetyl(cyclohexyl)amino]phenyl] N-methyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 91520177 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [4-[acetyl(cyclohexyl)amino]phenyl] N-methyl-N-phenylcarbamate |
| SMILES | CC(=O)N(c1ccc(OC(=O)N(C)c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H26N2O3/c1-17(25)24(19-11-7-4-8-12-19)20-13-15-21(16-14-20)27-22(26)23(2)18-9-5-3-6-10-18/h3,5-6,9-10,13-16,19H,4,7-8,11-12H2,1-2H3 |
| InChIKey | KBOXDUBNOKBWJZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |